CAS 1609404-38-7 is the registry number for Trans-4-ethoxy-1-methyl-3-pyrrolidinamine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
(3S,4S)-4-ethoxy-1-methylpyrrolidin-3-amine;dihydrochloride (CAS 1609404-38-7) is a chemical compound with the molecular formula C7H18Cl2N2O and a molecular weight of 217.13 g/mol. IUPAC name: (3S,4S)-4-ethoxy-1-methylpyrrolidin-3-amine;dihydrochloride. InChIKey: LXWWPHFPQGBZPJ-JFYKYWLVSA-N.
| Molecular formula | C7H18Cl2N2O |
|---|---|
| Molecular weight | 217.13 g/mol |
| IUPAC name | (3S,4S)-4-ethoxy-1-methylpyrrolidin-3-amine;dihydrochloride |
| InChIKey | LXWWPHFPQGBZPJ-JFYKYWLVSA-N |
| SMILES | CCO[C@H]1CN(C[C@@H]1N)C.Cl.Cl |
Computed by PubChem (NCBI)