Products 40676-05-9

CAS 40676-05-9 is the registry number for 2-(4-Methylpiperazin-1-yl)ethanol dihydrochloride, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g, 100g, 500g.

Structural formula: {0} (CAS {1})

2-(4-methylpiperazin-1-yl)ethanol;dihydrochloride (CAS 40676-05-9) is a chemical compound with the molecular formula C7H18Cl2N2O and a molecular weight of 217.13 g/mol. IUPAC name: 2-(4-methylpiperazin-1-yl)ethanol;dihydrochloride. InChIKey: HXCPDXDIPCULNJ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H18Cl2N2O
Molecular weight217.13 g/mol
IUPAC name2-(4-methylpiperazin-1-yl)ethanol;dihydrochloride
InChIKeyHXCPDXDIPCULNJ-UHFFFAOYSA-N
SMILESCN1CCN(CC1)CCO.Cl.Cl

Computed by PubChem (NCBI)