CAS 1609400-88-5 appears in our catalog under these names: ([5-(2-Furyl)-1,2,4-oxadiazol-3-yl]methyl)amine hydrochloride, 95%, {(5-(2-Furyl)-1,2,4-oxadiazol-3-yl)methyl}amine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g.
[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methanamine;hydrochloride (CAS 1609400-88-5) is a chemical compound with the molecular formula C7H8ClN3O2 and a molecular weight of 201.61 g/mol. IUPAC name: [5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methanamine;hydrochloride. InChIKey: GUSJRAQZMHEICA-UHFFFAOYSA-N.
| Molecular formula | C7H8ClN3O2 |
|---|---|
| Molecular weight | 201.61 g/mol |
| IUPAC name | [5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methanamine;hydrochloride |
| InChIKey | GUSJRAQZMHEICA-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=NC(=NO2)CN.Cl |
Computed by PubChem (NCBI)