Products 1820705-93-8
CAS 1820705-93-8 is the registry number for 5-Chloro-N,N-dimethyl-3-nitropyridin-2-amine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
5-chloro-N,N-dimethyl-3-nitropyridin-2-amine (CAS 1820705-93-8) is a chemical compound with the molecular formula C7H8ClN3O2 and a molecular weight of 201.61 g/mol. IUPAC name: 5-chloro-N,N-dimethyl-3-nitropyridin-2-amine. InChIKey: ZVOKEOADEACZOZ-UHFFFAOYSA-N.
| Molecular formula | C7H8ClN3O2 |
|---|---|
| Molecular weight | 201.61 g/mol |
| IUPAC name | 5-chloro-N,N-dimethyl-3-nitropyridin-2-amine |
| InChIKey | ZVOKEOADEACZOZ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=C(C=N1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)