CAS 33742-69-7 is the registry number for 6-Chloro-N-ethyl-3-nitropyridin-2-amine, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
6-chloro-N-ethyl-3-nitropyridin-2-amine (CAS 33742-69-7) is a chemical compound with the molecular formula C7H8ClN3O2 and a molecular weight of 201.61 g/mol. IUPAC name: 6-chloro-N-ethyl-3-nitropyridin-2-amine. InChIKey: TXERJEKFMCQUFL-UHFFFAOYSA-N.
| Molecular formula | C7H8ClN3O2 |
|---|---|
| Molecular weight | 201.61 g/mol |
| IUPAC name | 6-chloro-N-ethyl-3-nitropyridin-2-amine |
| InChIKey | TXERJEKFMCQUFL-UHFFFAOYSA-N |
| SMILES | CCNC1=C(C=CC(=N1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)