CAS 1609402-89-2 appears in our catalog under these names: (4,5-Dimethyl-1h-imidazol-1-yl)acetic acid hydrochloride, 95%, (4,5-Dimethyl-1H-imidazol-1-yl)acetic acid hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 5g, 0,5g.
2-(4,5-dimethylimidazol-1-yl)acetic acid;hydrochloride (CAS 1609402-89-2) is a chemical compound with the molecular formula C7H11ClN2O2 and a molecular weight of 190.63 g/mol. IUPAC name: 2-(4,5-dimethylimidazol-1-yl)acetic acid;hydrochloride. InChIKey: KXOWISYQOJQDJD-UHFFFAOYSA-N.
| Molecular formula | C7H11ClN2O2 |
|---|---|
| Molecular weight | 190.63 g/mol |
| IUPAC name | 2-(4,5-dimethylimidazol-1-yl)acetic acid;hydrochloride |
| InChIKey | KXOWISYQOJQDJD-UHFFFAOYSA-N |
| SMILES | CC1=C(N(C=N1)CC(=O)O)C.Cl |
Computed by PubChem (NCBI)