Products 1609403-76-0

CAS 1609403-76-0 is the registry number for 3-Methyl-4-oxo-3,4-dihydro-7-quinazolinecarboxylic acid hydrochloride, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

3-methyl-4-oxoquinazoline-7-carboxylic acid;hydrochloride (CAS 1609403-76-0) is a chemical compound with the molecular formula C10H9ClN2O3 and a molecular weight of 240.64 g/mol. IUPAC name: 3-methyl-4-oxoquinazoline-7-carboxylic acid;hydrochloride. InChIKey: RBNAXUVKIJHYOB-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9ClN2O3
Molecular weight240.64 g/mol
IUPAC name3-methyl-4-oxoquinazoline-7-carboxylic acid;hydrochloride
InChIKeyRBNAXUVKIJHYOB-UHFFFAOYSA-N
SMILESCN1C=NC2=C(C1=O)C=CC(=C2)C(=O)O.Cl

Computed by PubChem (NCBI)