CAS 1609403-76-0 is the registry number for 3-Methyl-4-oxo-3,4-dihydro-7-quinazolinecarboxylic acid hydrochloride, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
3-methyl-4-oxoquinazoline-7-carboxylic acid;hydrochloride (CAS 1609403-76-0) is a chemical compound with the molecular formula C10H9ClN2O3 and a molecular weight of 240.64 g/mol. IUPAC name: 3-methyl-4-oxoquinazoline-7-carboxylic acid;hydrochloride. InChIKey: RBNAXUVKIJHYOB-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O3 |
|---|---|
| Molecular weight | 240.64 g/mol |
| IUPAC name | 3-methyl-4-oxoquinazoline-7-carboxylic acid;hydrochloride |
| InChIKey | RBNAXUVKIJHYOB-UHFFFAOYSA-N |
| SMILES | CN1C=NC2=C(C1=O)C=CC(=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)