Products 933682-39-4

CAS 933682-39-4 is the registry number for [(5-Chloro-1H-benzimidazol-2-yl)methoxy]-acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(6-chloro-1H-benzimidazol-2-yl)methoxy]acetic acid (CAS 933682-39-4) is a chemical compound with the molecular formula C10H9ClN2O3 and a molecular weight of 240.64 g/mol. IUPAC name: 2-[(6-chloro-1H-benzimidazol-2-yl)methoxy]acetic acid. InChIKey: QLDIWZGKHFMSHT-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9ClN2O3
Molecular weight240.64 g/mol
IUPAC name2-[(6-chloro-1H-benzimidazol-2-yl)methoxy]acetic acid
InChIKeyQLDIWZGKHFMSHT-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1Cl)NC(=N2)COCC(=O)O

Computed by PubChem (NCBI)