Products 87866-12-4
CAS 87866-12-4 is the registry number for 2-Chloro-1-(6-nitro-2,3-dihydro-1h-indol-1-yl)ethan-1-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
2-chloro-1-(6-nitro-2,3-dihydroindol-1-yl)ethanone (CAS 87866-12-4) is a chemical compound with the molecular formula C10H9ClN2O3 and a molecular weight of 240.64 g/mol. IUPAC name: 2-chloro-1-(6-nitro-2,3-dihydroindol-1-yl)ethanone. InChIKey: HZENLBQVZSRAMH-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O3 |
|---|---|
| Molecular weight | 240.64 g/mol |
| IUPAC name | 2-chloro-1-(6-nitro-2,3-dihydroindol-1-yl)ethanone |
| InChIKey | HZENLBQVZSRAMH-UHFFFAOYSA-N |
| SMILES | C1CN(C2=C1C=CC(=C2)[N+](=O)[O-])C(=O)CCl |
Computed by PubChem (NCBI)