CAS 1609406-55-4 appears in our catalog under these names: 2-(2-Chloroethyl)-6,7-dimethyl-1h-benzimidazole hydrochloride, 95%, 2-(2-Chloroethyl)-6,7-dimethyl-1H-benzo(d)imidazole hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(2-chloroethyl)-4,5-dimethyl-1H-benzimidazole;hydrochloride (CAS 1609406-55-4) is a chemical compound with the molecular formula C11H14Cl2N2 and a molecular weight of 245.14 g/mol. IUPAC name: 2-(2-chloroethyl)-4,5-dimethyl-1H-benzimidazole;hydrochloride. InChIKey: ITTKFMOKPHZEET-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl2N2 |
|---|---|
| Molecular weight | 245.14 g/mol |
| IUPAC name | 2-(2-chloroethyl)-4,5-dimethyl-1H-benzimidazole;hydrochloride |
| InChIKey | ITTKFMOKPHZEET-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)NC(=N2)CCCl)C.Cl |
Computed by PubChem (NCBI)