CAS 1700624-79-8 is the registry number for N-(tert-Butyl)-2,6-dichlorobenzimidamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
N'-tert-butyl-2,6-dichlorobenzenecarboximidamide (CAS 1700624-79-8) is a chemical compound with the molecular formula C11H14Cl2N2 and a molecular weight of 245.14 g/mol. IUPAC name: N'-tert-butyl-2,6-dichlorobenzenecarboximidamide. InChIKey: XDZBGYYFYQANOV-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl2N2 |
|---|---|
| Molecular weight | 245.14 g/mol |
| IUPAC name | N'-tert-butyl-2,6-dichlorobenzenecarboximidamide |
| InChIKey | XDZBGYYFYQANOV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N=C(C1=C(C=CC=C1Cl)Cl)N |
Computed by PubChem (NCBI)