CAS 2031258-65-6 appears in our catalog under these names: 2-(Quinolin-3-yl)ethan-1-amine dihydrochloride, 95%, 2-(Quinolin-3-yl)ethan-1-amine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-quinolin-3-ylethanamine;dihydrochloride (CAS 2031258-65-6) is a chemical compound with the molecular formula C11H14Cl2N2 and a molecular weight of 245.14 g/mol. IUPAC name: 2-quinolin-3-ylethanamine;dihydrochloride. InChIKey: IOPVFVYTTCNTCZ-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl2N2 |
|---|---|
| Molecular weight | 245.14 g/mol |
| IUPAC name | 2-quinolin-3-ylethanamine;dihydrochloride |
| InChIKey | IOPVFVYTTCNTCZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=N2)CCN.Cl.Cl |
Computed by PubChem (NCBI)