Products 1609406-87-2

CAS 1609406-87-2 is the registry number for 1,4,5-Trimethyl-1,3-dihydro-2h-imidazol-2-one trifluoroacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

2,2,2-trifluoroacetic acid;3,4,5-trimethyl-1H-imidazol-2-one (CAS 1609406-87-2) is a chemical compound with the molecular formula C8H11F3N2O3 and a molecular weight of 240.18 g/mol. IUPAC name: 2,2,2-trifluoroacetic acid;3,4,5-trimethyl-1H-imidazol-2-one. InChIKey: XNHCEUQLHQJRGX-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11F3N2O3
Molecular weight240.18 g/mol
IUPAC name2,2,2-trifluoroacetic acid;3,4,5-trimethyl-1H-imidazol-2-one
InChIKeyXNHCEUQLHQJRGX-UHFFFAOYSA-N
SMILESCC1=C(N(C(=O)N1)C)C.C(=O)(C(F)(F)F)O

Computed by PubChem (NCBI)