CAS 2228784-02-7 appears in our catalog under these names: 2,6-Diazaspiro(3.4)octan-7-one 2,2,2-trifluoroacetate, 97%, 2,6-Diazaspiro(3.4)octan-7-one, trifluoroacetic acid, 2,6-diazaspiro[3.4]octan-7-one, trifluoroacetic acid, 97%, 97%, 2,6-Diazaspiro[3.4]octan-7-one 2,2,2-trifluoroacetate, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 2,5g, 250mg, 100mg.
2,6-diazaspiro[3.4]octan-7-one;2,2,2-trifluoroacetic acid (CAS 2228784-02-7) is a chemical compound with the molecular formula C8H11F3N2O3 and a molecular weight of 240.18 g/mol. IUPAC name: 2,6-diazaspiro[3.4]octan-7-one;2,2,2-trifluoroacetic acid. InChIKey: MPNPHRMKZTUFGZ-UHFFFAOYSA-N.
| Molecular formula | C8H11F3N2O3 |
|---|---|
| Molecular weight | 240.18 g/mol |
| IUPAC name | 2,6-diazaspiro[3.4]octan-7-one;2,2,2-trifluoroacetic acid |
| InChIKey | MPNPHRMKZTUFGZ-UHFFFAOYSA-N |
| SMILES | C1C(=O)NCC12CNC2.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)