Products 2426624-83-9
CAS 2426624-83-9 is the registry number for 1-(3-Aminoazetidin-1-yl)prop-2-en-1-one 2,2,2-trifluoroacetate, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(3-aminoazetidin-1-yl)prop-2-en-1-one;2,2,2-trifluoroacetic acid (CAS 2426624-83-9) is a chemical compound with the molecular formula C8H11F3N2O3 and a molecular weight of 240.18 g/mol. IUPAC name: 1-(3-aminoazetidin-1-yl)prop-2-en-1-one;2,2,2-trifluoroacetic acid. InChIKey: WZOAQCPAWCEGDB-UHFFFAOYSA-N.
| Molecular formula | C8H11F3N2O3 |
|---|---|
| Molecular weight | 240.18 g/mol |
| IUPAC name | 1-(3-aminoazetidin-1-yl)prop-2-en-1-one;2,2,2-trifluoroacetic acid |
| InChIKey | WZOAQCPAWCEGDB-UHFFFAOYSA-N |
| SMILES | C=CC(=O)N1CC(C1)N.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)