Products 160955-96-4
CAS 160955-96-4 is the registry number for N-(3-Methoxybenzylidene)-4-methylbenzenesulfonamide, 97%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
N-[(3-methoxyphenyl)methylidene]-4-methylbenzenesulfonamide (CAS 160955-96-4) is a chemical compound with the molecular formula C15H15NO3S and a molecular weight of 289.4 g/mol. IUPAC name: N-[(3-methoxyphenyl)methylidene]-4-methylbenzenesulfonamide. InChIKey: UWXPZFJCRZLJGY-UHFFFAOYSA-N.
| Molecular formula | C15H15NO3S |
|---|---|
| Molecular weight | 289.4 g/mol |
| IUPAC name | N-[(3-methoxyphenyl)methylidene]-4-methylbenzenesulfonamide |
| InChIKey | UWXPZFJCRZLJGY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N=CC2=CC(=CC=C2)OC |
Computed by PubChem (NCBI)