Products 1803241-11-3
CAS 1803241-11-3 is the registry number for Fmoc-(R)-γ-Allyl-L-proline, 98%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-prop-2-enylpyrrolidine-2-carboxylic acid (CAS 1803241-11-3) is a chemical compound with the molecular formula C23H23NO4 and a molecular weight of 377.4 g/mol. IUPAC name: (2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-prop-2-enylpyrrolidine-2-carboxylic acid. InChIKey: HCTIBKWJQNADEQ-VFNWGFHPSA-N.
| Molecular formula | C23H23NO4 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | (2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-prop-2-enylpyrrolidine-2-carboxylic acid |
| InChIKey | HCTIBKWJQNADEQ-VFNWGFHPSA-N |
| SMILES | C=CC[C@@H]1C[C@H](N(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)