Products 1609628-72-9
CAS 1609628-72-9 is the registry number for Schibitubin I. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(1S,2R)-1-(3,4-dimethoxyphenyl)-2-methyl-3-oxobutyl] 3,4-dimethoxybenzoate (CAS 1609628-72-9) is a chemical compound with the molecular formula C22H26O7 and a molecular weight of 402.4 g/mol. IUPAC name: [(1S,2R)-1-(3,4-dimethoxyphenyl)-2-methyl-3-oxobutyl] 3,4-dimethoxybenzoate. InChIKey: AGVOQRRWXUMWQJ-ZSEKCTLFSA-N.
| Molecular formula | C22H26O7 |
|---|---|
| Molecular weight | 402.4 g/mol |
| IUPAC name | [(1S,2R)-1-(3,4-dimethoxyphenyl)-2-methyl-3-oxobutyl] 3,4-dimethoxybenzoate |
| InChIKey | AGVOQRRWXUMWQJ-ZSEKCTLFSA-N |
| SMILES | C[C@H]([C@@H](C1=CC(=C(C=C1)OC)OC)OC(=O)C2=CC(=C(C=C2)OC)OC)C(=O)C |
Computed by PubChem (NCBI)