Products 216752-89-5
CAS 216752-89-5 is the registry number for Habenariol. Offered by: MedChemExpress. Available pack sizes: Get quote.
Bis[(4-hydroxyphenyl)methyl] (2R)-2-hydroxy-2-(2-methylpropyl)butanedioate (CAS 216752-89-5) is a chemical compound with the molecular formula C22H26O7 and a molecular weight of 402.4 g/mol. IUPAC name: bis[(4-hydroxyphenyl)methyl] (2R)-2-hydroxy-2-(2-methylpropyl)butanedioate. InChIKey: IKKNRVAESCIIGG-JOCHJYFZSA-N.
| Molecular formula | C22H26O7 |
|---|---|
| Molecular weight | 402.4 g/mol |
| IUPAC name | bis[(4-hydroxyphenyl)methyl] (2R)-2-hydroxy-2-(2-methylpropyl)butanedioate |
| InChIKey | IKKNRVAESCIIGG-JOCHJYFZSA-N |
| SMILES | CC(C)C[C@@](CC(=O)OCC1=CC=C(C=C1)O)(C(=O)OCC2=CC=C(C=C2)O)O |
Computed by PubChem (NCBI)