Products 79114-77-5
CAS 79114-77-5 is the registry number for Lariciresinol acetate. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, Get quote.
[(2S,3R,4R)-2-(4-hydroxy-3-methoxyphenyl)-4-[(4-hydroxy-3-methoxyphenyl)methyl]oxolan-3-yl]methyl acetate (CAS 79114-77-5) is a chemical compound with the molecular formula C22H26O7 and a molecular weight of 402.4 g/mol. IUPAC name: [(2S,3R,4R)-2-(4-hydroxy-3-methoxyphenyl)-4-[(4-hydroxy-3-methoxyphenyl)methyl]oxolan-3-yl]methyl acetate. InChIKey: LVYMIYJFCKIBMR-PNLZDCPESA-N.
| Molecular formula | C22H26O7 |
|---|---|
| Molecular weight | 402.4 g/mol |
| IUPAC name | [(2S,3R,4R)-2-(4-hydroxy-3-methoxyphenyl)-4-[(4-hydroxy-3-methoxyphenyl)methyl]oxolan-3-yl]methyl acetate |
| InChIKey | LVYMIYJFCKIBMR-PNLZDCPESA-N |
| SMILES | CC(=O)OC[C@H]1[C@H](CO[C@@H]1C2=CC(=C(C=C2)O)OC)CC3=CC(=C(C=C3)O)OC |
Computed by PubChem (NCBI)
Synonyms:
Lariciresinol acetate, orb1682234