CAS 1610370-40-5 is the registry number for 2'-Fluoro-5'-methoxy-3-methyl-[1,1'-biphenyl]-4-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-(2-fluoro-5-methoxyphenyl)-2-methylbenzaldehyde (CAS 1610370-40-5) is a chemical compound with the molecular formula C15H13FO2 and a molecular weight of 244.26 g/mol. IUPAC name: 4-(2-fluoro-5-methoxyphenyl)-2-methylbenzaldehyde. InChIKey: WSMCWUDLYDBYHO-UHFFFAOYSA-N.
| Molecular formula | C15H13FO2 |
|---|---|
| Molecular weight | 244.26 g/mol |
| IUPAC name | 4-(2-fluoro-5-methoxyphenyl)-2-methylbenzaldehyde |
| InChIKey | WSMCWUDLYDBYHO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=C(C=CC(=C2)OC)F)C=O |
Computed by PubChem (NCBI)