CAS 1610585-67-5 is the registry number for (6-(1-methyl-1H-pyrazol-4-yl)pyridin-3-yl)methanamine, 98%. Offered by: AmBeed. Available pack sizes: 1g.
[6-(1-methylpyrazol-4-yl)-3-pyridinyl]methanamine (CAS 1610585-67-5) is a chemical compound with the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. IUPAC name: [6-(1-methylpyrazol-4-yl)-3-pyridinyl]methanamine. InChIKey: QAJUGBYUONHRNH-UHFFFAOYSA-N.
| Molecular formula | C10H12N4 |
|---|---|
| Molecular weight | 188.23 g/mol |
| IUPAC name | [6-(1-methylpyrazol-4-yl)-3-pyridinyl]methanamine |
| InChIKey | QAJUGBYUONHRNH-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)C2=NC=C(C=C2)CN |
Computed by PubChem (NCBI)