CAS 1610802-47-5 appears in our catalog under these names: LY3130481, LY 3130481, 99.84%, 99.84%, LY3130481, 99.73%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 25mg, 50mg, 100mg, 1mg, 10mM (in 1ml dmso), 10mg, 250mg.
6-[(1S)-1-[1-[5-(2-hydroxyethoxy)-2-pyridinyl]pyrazol-3-yl]ethyl]-3H-1,3-benzothiazol-2-one (CAS 1610802-47-5) is a chemical compound with the molecular formula C19H18N4O3S and a molecular weight of 382.4 g/mol. IUPAC name: 6-[(1S)-1-[1-[5-(2-hydroxyethoxy)-2-pyridinyl]pyrazol-3-yl]ethyl]-3H-1,3-benzothiazol-2-one. InChIKey: HLTKOFPQDKJCAN-LBPRGKRZSA-N.
| Molecular formula | C19H18N4O3S |
|---|---|
| Molecular weight | 382.4 g/mol |
| IUPAC name | 6-[(1S)-1-[1-[5-(2-hydroxyethoxy)-2-pyridinyl]pyrazol-3-yl]ethyl]-3H-1,3-benzothiazol-2-one |
| InChIKey | HLTKOFPQDKJCAN-LBPRGKRZSA-N |
| SMILES | C[C@@H](C1=CC2=C(C=C1)NC(=O)S2)C3=NN(C=C3)C4=NC=C(C=C4)OCCO |
Computed by PubChem (NCBI)