Products 454436-75-0
CAS 454436-75-0 is the registry number for EGFR-IN-52. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(1,3-benzodioxol-5-yl)-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)thiourea (CAS 454436-75-0) is a chemical compound with the molecular formula C19H18N4O3S and a molecular weight of 382.4 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)thiourea. InChIKey: ZNMSKFVKBVCPAJ-UHFFFAOYSA-N.
| Molecular formula | C19H18N4O3S |
|---|---|
| Molecular weight | 382.4 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)thiourea |
| InChIKey | ZNMSKFVKBVCPAJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(N1C)C2=CC=CC=C2)NC(=S)NC3=CC4=C(C=C3)OCO4 |
Computed by PubChem (NCBI)