Products 875863-22-2
CAS 875863-22-2 appears in our catalog under these names: STING Agonist C11, STING Agonist C11, STING agonist-15, 99.0%. Offered by: TargetMol, GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 500ug, 500μg, 500 μg.
N-(methylcarbamoyl)-2-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-2-phenylacetamide (CAS 875863-22-2) is a chemical compound with the molecular formula C19H18N4O3S and a molecular weight of 382.4 g/mol. IUPAC name: N-(methylcarbamoyl)-2-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-2-phenylacetamide. InChIKey: KQKWXSQTTDLZSO-UHFFFAOYSA-N.
| Molecular formula | C19H18N4O3S |
|---|---|
| Molecular weight | 382.4 g/mol |
| IUPAC name | N-(methylcarbamoyl)-2-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-2-phenylacetamide |
| InChIKey | KQKWXSQTTDLZSO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NN=C(O2)SC(C3=CC=CC=C3)C(=O)NC(=O)NC |
Computed by PubChem (NCBI)