Products 161096-82-8
CAS 161096-82-8 appears in our catalog under these names: Oxaloacetic Acid-13C4, >95% (HPLC), Oxaloacetic acid–13C4, Oxaloacetic acid-13C4, Oxaloacetic Acid-13C4, 98%, 98%, Oxaloacetic acid-13C4, 99.23%. Offered by: TRC, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 2,5mg, 5mg, 2mg, 1 mg.
2-oxo(1,2,3,4-13C4)butanedioic acid (CAS 161096-82-8) is a chemical compound with the molecular formula C4H4O5 and a molecular weight of 136.04 g/mol. IUPAC name: 2-oxo(1,2,3,4-13C4)butanedioic acid. InChIKey: KHPXUQMNIQBQEV-JCDJMFQYSA-N.
| Molecular formula | C4H4O5 |
|---|---|
| Molecular weight | 136.04 g/mol |
| IUPAC name | 2-oxo(1,2,3,4-13C4)butanedioic acid |
| InChIKey | KHPXUQMNIQBQEV-JCDJMFQYSA-N |
| SMILES | [13CH2]([13C](=O)[13C](=O)O)[13C](=O)O |
Computed by PubChem (NCBI)