Products 871835-30-2

CAS 871835-30-2 is the registry number for 2-Oxo-1,3-dioxolane-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-oxo-1,3-dioxolane-4-carboxylic acid (CAS 871835-30-2) is a chemical compound with the molecular formula C4H4O5 and a molecular weight of 132.07 g/mol. IUPAC name: 2-oxo-1,3-dioxolane-4-carboxylic acid. InChIKey: INDZWIZFONXCIY-UHFFFAOYSA-N.

Identity
Molecular formulaC4H4O5
Molecular weight132.07 g/mol
IUPAC name2-oxo-1,3-dioxolane-4-carboxylic acid
InChIKeyINDZWIZFONXCIY-UHFFFAOYSA-N
SMILESC1C(OC(=O)O1)C(=O)O

Computed by PubChem (NCBI)