CAS 16533-72-5 appears in our catalog under these names: Cis-epoxysuccinic acid, 97%, cis-Epoxysuccinic acid, 99%, cis–Epoxysuccinic acid, cis-Epoxysuccinic acid, cis-Epoxysuccinic Acid, >97.0%(GC)(T). Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, TCI. Available pack sizes: 25g, 1g, 5g, 100mg, 500mg, 50g, 10mM/1mL, 100 mg.
(2R,3S)-oxirane-2,3-dicarboxylic acid (CAS 16533-72-5) is a chemical compound with the molecular formula C4H4O5 and a molecular weight of 132.07 g/mol. IUPAC name: (2R,3S)-oxirane-2,3-dicarboxylic acid. InChIKey: DCEMCPAKSGRHCN-XIXRPRMCSA-N.
| Molecular formula | C4H4O5 |
|---|---|
| Molecular weight | 132.07 g/mol |
| IUPAC name | (2R,3S)-oxirane-2,3-dicarboxylic acid |
| InChIKey | DCEMCPAKSGRHCN-XIXRPRMCSA-N |
| SMILES | [C@@H]1([C@H](O1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)