CAS 1612176-17-6 is the registry number for tert-Butyl 3,5-difluoro-4-oxopiperidine-1-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3,5-difluoro-4-oxopiperidine-1-carboxylate (CAS 1612176-17-6) is a chemical compound with the molecular formula C10H15F2NO3 and a molecular weight of 235.23 g/mol. IUPAC name: tert-butyl 3,5-difluoro-4-oxopiperidine-1-carboxylate. InChIKey: MWKMVSDVUBMEKD-UHFFFAOYSA-N.
| Molecular formula | C10H15F2NO3 |
|---|---|
| Molecular weight | 235.23 g/mol |
| IUPAC name | tert-butyl 3,5-difluoro-4-oxopiperidine-1-carboxylate |
| InChIKey | MWKMVSDVUBMEKD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C(=O)C(C1)F)F |
Computed by PubChem (NCBI)