CAS 2287955-97-7 is the registry number for tert-Butyl 3,3-difluoro-4-formylpyrrolidine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 0,25g, 1g, 5g.
Tert-butyl 3,3-difluoro-4-formylpyrrolidine-1-carboxylate (CAS 2287955-97-7) is a chemical compound with the molecular formula C10H15F2NO3 and a molecular weight of 235.23 g/mol. IUPAC name: tert-butyl 3,3-difluoro-4-formylpyrrolidine-1-carboxylate. InChIKey: FJXMHXINNWXBFP-UHFFFAOYSA-N.
| Molecular formula | C10H15F2NO3 |
|---|---|
| Molecular weight | 235.23 g/mol |
| IUPAC name | tert-butyl 3,3-difluoro-4-formylpyrrolidine-1-carboxylate |
| InChIKey | FJXMHXINNWXBFP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C(C1)(F)F)C=O |
Computed by PubChem (NCBI)