CAS 1628502-51-1 is the registry number for (R)-1-Boc-4,4-difluoropyrrolidine-2-carbaldehyde, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Tert-butyl (2R)-4,4-difluoro-2-formylpyrrolidine-1-carboxylate (CAS 1628502-51-1) is a chemical compound with the molecular formula C10H15F2NO3 and a molecular weight of 235.23 g/mol. IUPAC name: tert-butyl (2R)-4,4-difluoro-2-formylpyrrolidine-1-carboxylate. InChIKey: AOVSULZRHILJIN-SSDOTTSWSA-N.
| Molecular formula | C10H15F2NO3 |
|---|---|
| Molecular weight | 235.23 g/mol |
| IUPAC name | tert-butyl (2R)-4,4-difluoro-2-formylpyrrolidine-1-carboxylate |
| InChIKey | AOVSULZRHILJIN-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C[C@@H]1C=O)(F)F |
Computed by PubChem (NCBI)