Products 161265-32-3
CAS 161265-32-3 appears in our catalog under these names: 3-(2-Carboxyethyl)benzoic acid, 95%, 3-(2-Carboxyethyl)benzoic acid, 98%, 3-(2-Carboxyethyl)Benzoic Acid, 98%, 98%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 100mg, 5g.
3-(2-carboxyethyl)benzoic acid (CAS 161265-32-3) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 3-(2-carboxyethyl)benzoic acid. InChIKey: XUOCLOJWCPUKCS-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 3-(2-carboxyethyl)benzoic acid |
| InChIKey | XUOCLOJWCPUKCS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)CCC(=O)O |
Computed by PubChem (NCBI)