CAS 1613049-74-3 appears in our catalog under these names: (2E)-3-(5-Methyl-3-pyridinyl)-2-propenoic acid, 97%, (2E)-3-(5-Methyl-3-pyridinyl)-2-propenoic acid, 97%, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
(E)-3-(5-methyl-3-pyridinyl)prop-2-enoic acid (CAS 1613049-74-3) is a chemical compound with the molecular formula C9H9NO2 and a molecular weight of 163.17 g/mol. IUPAC name: (E)-3-(5-methyl-3-pyridinyl)prop-2-enoic acid. InChIKey: SUGXXVWXQDDZFV-NSCUHMNNSA-N.
| Molecular formula | C9H9NO2 |
|---|---|
| Molecular weight | 163.17 g/mol |
| IUPAC name | (E)-3-(5-methyl-3-pyridinyl)prop-2-enoic acid |
| InChIKey | SUGXXVWXQDDZFV-NSCUHMNNSA-N |
| SMILES | CC1=CC(=CN=C1)/C=C/C(=O)O |
Computed by PubChem (NCBI)