CAS 1613316-63-4 is the registry number for 4,7-Dibromo-5,6-dimethyl-1H-benzo[d]imidazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,7-dibromo-5,6-dimethyl-1H-benzimidazole (CAS 1613316-63-4) is a chemical compound with the molecular formula C9H8Br2N2 and a molecular weight of 303.98 g/mol. IUPAC name: 4,7-dibromo-5,6-dimethyl-1H-benzimidazole. InChIKey: BHFUTZWLZWYAEJ-UHFFFAOYSA-N.
| Molecular formula | C9H8Br2N2 |
|---|---|
| Molecular weight | 303.98 g/mol |
| IUPAC name | 4,7-dibromo-5,6-dimethyl-1H-benzimidazole |
| InChIKey | BHFUTZWLZWYAEJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C2C(=C1Br)NC=N2)Br)C |
Computed by PubChem (NCBI)