CAS 2413441-15-1 is the registry number for 3,8-Dibromo-2,6-dimethylimidazo[1,2-a]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
3,8-dibromo-2,6-dimethylimidazo[1,2-a]pyridine (CAS 2413441-15-1) is a chemical compound with the molecular formula C9H8Br2N2 and a molecular weight of 303.98 g/mol. IUPAC name: 3,8-dibromo-2,6-dimethylimidazo[1,2-a]pyridine. InChIKey: PORRCWTXNKDXRP-UHFFFAOYSA-N.
| Molecular formula | C9H8Br2N2 |
|---|---|
| Molecular weight | 303.98 g/mol |
| IUPAC name | 3,8-dibromo-2,6-dimethylimidazo[1,2-a]pyridine |
| InChIKey | PORRCWTXNKDXRP-UHFFFAOYSA-N |
| SMILES | CC1=CN2C(=C(N=C2C(=C1)Br)C)Br |
Computed by PubChem (NCBI)