CAS 362525-66-4 is the registry number for 6,8-Dibromo-2,3-dimethylimidazo[1,2-a]pyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6,8-dibromo-2,3-dimethylimidazo[1,2-a]pyridine (CAS 362525-66-4) is a chemical compound with the molecular formula C9H8Br2N2 and a molecular weight of 303.98 g/mol. IUPAC name: 6,8-dibromo-2,3-dimethylimidazo[1,2-a]pyridine. InChIKey: YTVAVHFVWDJYTF-UHFFFAOYSA-N.
| Molecular formula | C9H8Br2N2 |
|---|---|
| Molecular weight | 303.98 g/mol |
| IUPAC name | 6,8-dibromo-2,3-dimethylimidazo[1,2-a]pyridine |
| InChIKey | YTVAVHFVWDJYTF-UHFFFAOYSA-N |
| SMILES | CC1=C(N2C=C(C=C(C2=N1)Br)Br)C |
Computed by PubChem (NCBI)