CAS 1613451-82-3 appears in our catalog under these names: 2'-Amino-3,3''-dihydroxy-[1,1':4',1''-terphenyl]-4,4''-dicarboxylic acid, 95%, 95%, 2'-Amino-3,3''-dihydroxy-[1,1':4',1''-terphenyl]-4,4''-dicarboxylic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-[3-amino-4-(4-carboxy-3-hydroxyphenyl)phenyl]-2-hydroxybenzoic acid (CAS 1613451-82-3) is a chemical compound with the molecular formula C20H15NO6 and a molecular weight of 365.3 g/mol. IUPAC name: 4-[3-amino-4-(4-carboxy-3-hydroxyphenyl)phenyl]-2-hydroxybenzoic acid. InChIKey: WAANJOYICYHUFX-UHFFFAOYSA-N.
| Molecular formula | C20H15NO6 |
|---|---|
| Molecular weight | 365.3 g/mol |
| IUPAC name | 4-[3-amino-4-(4-carboxy-3-hydroxyphenyl)phenyl]-2-hydroxybenzoic acid |
| InChIKey | WAANJOYICYHUFX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=C(C=C2)C(=O)O)O)N)C3=CC(=C(C=C3)C(=O)O)O |
Computed by PubChem (NCBI)