CAS 887407-36-5 is the registry number for 2-((6,7-Dimethoxy-2-oxo-2H-chromen-4-yl)methyl)isoindoline-1,3-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(6,7-dimethoxy-2-oxochromen-4-yl)methyl]isoindole-1,3-dione (CAS 887407-36-5) is a chemical compound with the molecular formula C20H15NO6 and a molecular weight of 365.3 g/mol. IUPAC name: 2-[(6,7-dimethoxy-2-oxochromen-4-yl)methyl]isoindole-1,3-dione. InChIKey: DQVDKHBDSXMBEO-UHFFFAOYSA-N.
| Molecular formula | C20H15NO6 |
|---|---|
| Molecular weight | 365.3 g/mol |
| IUPAC name | 2-[(6,7-dimethoxy-2-oxochromen-4-yl)methyl]isoindole-1,3-dione |
| InChIKey | DQVDKHBDSXMBEO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=CC(=O)O2)CN3C(=O)C4=CC=CC=C4C3=O)OC |
Computed by PubChem (NCBI)