CAS 2256751-16-1 is the registry number for STAT3-IN-29. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[(3,4-dimethoxyphenyl)methyl]-5-hydroxybenzo[f][1,2]benzoxazole-4,9-dione (CAS 2256751-16-1) is a chemical compound with the molecular formula C20H15NO6 and a molecular weight of 365.3 g/mol. IUPAC name: 3-[(3,4-dimethoxyphenyl)methyl]-5-hydroxybenzo[f][1,2]benzoxazole-4,9-dione. InChIKey: PMQIIXTVNYEQTA-UHFFFAOYSA-N.
| Molecular formula | C20H15NO6 |
|---|---|
| Molecular weight | 365.3 g/mol |
| IUPAC name | 3-[(3,4-dimethoxyphenyl)methyl]-5-hydroxybenzo[f][1,2]benzoxazole-4,9-dione |
| InChIKey | PMQIIXTVNYEQTA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CC2=NOC3=C2C(=O)C4=C(C3=O)C=CC=C4O)OC |
Computed by PubChem (NCBI)