CAS 432530-68-2 is the registry number for methyl 5-(((1,3-dioxoindan-2-ylidene)methyl)amino)-3-(methoxycarbonyl)benzoate. Offered by: Biosynth. Available pack sizes: 250mg.
Dimethyl 5-[(1-hydroxy-3-oxoinden-2-yl)methylideneamino]benzene-1,3-dicarboxylate (CAS 432530-68-2) is a chemical compound with the molecular formula C20H15NO6 and a molecular weight of 365.3 g/mol. IUPAC name: dimethyl 5-[(1-hydroxy-3-oxoinden-2-yl)methylideneamino]benzene-1,3-dicarboxylate. InChIKey: BXABBFXWKFIKDX-UHFFFAOYSA-N.
| Molecular formula | C20H15NO6 |
|---|---|
| Molecular weight | 365.3 g/mol |
| IUPAC name | dimethyl 5-[(1-hydroxy-3-oxoinden-2-yl)methylideneamino]benzene-1,3-dicarboxylate |
| InChIKey | BXABBFXWKFIKDX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)N=CC2=C(C3=CC=CC=C3C2=O)O)C(=O)OC |
Computed by PubChem (NCBI)