CAS 1613616-39-9 is the registry number for (E)-3-Hydrazonoindolin-2-one, 97%. Offered by: AmBeed. Available pack sizes: 1g.
3-diazenyl-1H-indol-2-ol (CAS 1613616-39-9) is a chemical compound with the molecular formula C8H7N3O and a molecular weight of 161.16 g/mol. IUPAC name: 3-diazenyl-1H-indol-2-ol. InChIKey: KWSQYVPIKHBAQV-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 3-diazenyl-1H-indol-2-ol |
| InChIKey | KWSQYVPIKHBAQV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(N2)O)N=N |
Computed by PubChem (NCBI)