CAS 2365-44-8 appears in our catalog under these names: 3-Hydrazonoindolin-2-one, 95%, Sunitinib Impurity 34, 3-Hydrazonoindolin-2-one, 95+%, 2-oxoindoline-3-hydrazone. Offered by: Combi-blocks, Chemat Brand, AmBeed, Biosynth. Available pack sizes: 1g, 5g, on request, 10g, 25g.
3-diazenyl-1H-indol-2-ol (CAS 2365-44-8) is a chemical compound with the molecular formula C8H7N3O and a molecular weight of 161.16 g/mol. IUPAC name: 3-diazenyl-1H-indol-2-ol. InChIKey: KWSQYVPIKHBAQV-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 3-diazenyl-1H-indol-2-ol |
| InChIKey | KWSQYVPIKHBAQV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(N2)O)N=N |
Computed by PubChem (NCBI)