CAS 161374-08-9 is the registry number for 6-Methyl-4-(4-nitrophenyl)-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylic acid ethyl ester. Offered by: Biosynth. Available pack sizes: 50mg.
Ethyl 6-methyl-4-(4-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (CAS 161374-08-9) is a chemical compound with the molecular formula C14H15N3O5 and a molecular weight of 305.29 g/mol. IUPAC name: ethyl 6-methyl-4-(4-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate. InChIKey: ZWSFKZZEYGSZRO-UHFFFAOYSA-N.
| Molecular formula | C14H15N3O5 |
|---|---|
| Molecular weight | 305.29 g/mol |
| IUPAC name | ethyl 6-methyl-4-(4-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| InChIKey | ZWSFKZZEYGSZRO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC(=O)NC1C2=CC=C(C=C2)[N+](=O)[O-])C |
Computed by PubChem (NCBI)