Products 2438123-69-2
CAS 2438123-69-2 is the registry number for N-(2-Butyl-6-nitro-1,3-dioxoisoindolin-5-yl)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2-butyl-6-nitro-1,3-dioxoisoindol-5-yl)acetamide (CAS 2438123-69-2) is a chemical compound with the molecular formula C14H15N3O5 and a molecular weight of 305.29 g/mol. IUPAC name: N-(2-butyl-6-nitro-1,3-dioxoisoindol-5-yl)acetamide. InChIKey: KFINCMROPIMUDZ-UHFFFAOYSA-N.
| Molecular formula | C14H15N3O5 |
|---|---|
| Molecular weight | 305.29 g/mol |
| IUPAC name | N-(2-butyl-6-nitro-1,3-dioxoisoindol-5-yl)acetamide |
| InChIKey | KFINCMROPIMUDZ-UHFFFAOYSA-N |
| SMILES | CCCCN1C(=O)C2=CC(=C(C=C2C1=O)[N+](=O)[O-])NC(=O)C |
Computed by PubChem (NCBI)