Products 2198584-62-0
CAS 2198584-62-0 is the registry number for Imazamox Metabolite M720H002, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: HPC Standards. Available pack sizes: 1x1ml.
2-(4-methyl-5-oxo-4-propan-2-yl-1H-imidazol-2-yl)pyridine-3,5-dicarboxylic acid (CAS 2198584-62-0) is a chemical compound with the molecular formula C14H15N3O5 and a molecular weight of 305.29 g/mol. IUPAC name: 2-(4-methyl-5-oxo-4-propan-2-yl-1H-imidazol-2-yl)pyridine-3,5-dicarboxylic acid. InChIKey: ZRPVTLGVORAGCY-UHFFFAOYSA-N.
| Molecular formula | C14H15N3O5 |
|---|---|
| Molecular weight | 305.29 g/mol |
| IUPAC name | 2-(4-methyl-5-oxo-4-propan-2-yl-1H-imidazol-2-yl)pyridine-3,5-dicarboxylic acid |
| InChIKey | ZRPVTLGVORAGCY-UHFFFAOYSA-N |
| SMILES | CC(C)C1(C(=O)NC(=N1)C2=C(C=C(C=N2)C(=O)O)C(=O)O)C |
Computed by PubChem (NCBI)
Synonyms:
5-Carboxy Imazapyr