Products 161448-78-8
CAS 161448-78-8 appears in our catalog under these names: Naphthalen-2-ylmethanesulfonyl chloride, Naphthalen-2-ylmethanesulfonyl chloride, 95%, 95%, (Naphthalen-2-yl)methanesulfonyl chloride, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 0,25g, 250mg, 1g.
Naphthalen-2-ylmethanesulfonyl chloride (CAS 161448-78-8) is a chemical compound with the molecular formula C11H9ClO2S and a molecular weight of 240.71 g/mol. IUPAC name: naphthalen-2-ylmethanesulfonyl chloride. InChIKey: PJHVZZODQMXUDU-UHFFFAOYSA-N.
| Molecular formula | C11H9ClO2S |
|---|---|
| Molecular weight | 240.71 g/mol |
| IUPAC name | naphthalen-2-ylmethanesulfonyl chloride |
| InChIKey | PJHVZZODQMXUDU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)