CAS 161462-33-5 appears in our catalog under these names: 1–cyano–2–methylthio–4–trifluoromethylbenzene, 2-(Methylthio)-4-(Trifluoromethyl)Benzonitrile, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 5g, 10g, 25g.
2-methylsulfanyl-4-(trifluoromethyl)benzonitrile (CAS 161462-33-5) is a chemical compound with the molecular formula C9H6F3NS and a molecular weight of 217.21 g/mol. IUPAC name: 2-methylsulfanyl-4-(trifluoromethyl)benzonitrile. InChIKey: KIBOKOLDHHKUPF-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NS |
|---|---|
| Molecular weight | 217.21 g/mol |
| IUPAC name | 2-methylsulfanyl-4-(trifluoromethyl)benzonitrile |
| InChIKey | KIBOKOLDHHKUPF-UHFFFAOYSA-N |
| SMILES | CSC1=C(C=CC(=C1)C(F)(F)F)C#N |
Computed by PubChem (NCBI)