CAS 1672663-81-8 appears in our catalog under these names: 2-(Difluoromethyl)-3-fluoro-6-(methylthio)benzonitrile, 97%, 2-(DIFLUOROMETHYL)-3-FLUORO-6-METHYLSULFANYL-BENZONITRILE, 97%. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg.
2-(difluoromethyl)-3-fluoro-6-methylsulfanylbenzonitrile (CAS 1672663-81-8) is a chemical compound with the molecular formula C9H6F3NS and a molecular weight of 217.21 g/mol. IUPAC name: 2-(difluoromethyl)-3-fluoro-6-methylsulfanylbenzonitrile. InChIKey: HKNCIYPJITXIEC-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NS |
|---|---|
| Molecular weight | 217.21 g/mol |
| IUPAC name | 2-(difluoromethyl)-3-fluoro-6-methylsulfanylbenzonitrile |
| InChIKey | HKNCIYPJITXIEC-UHFFFAOYSA-N |
| SMILES | CSC1=C(C(=C(C=C1)F)C(F)F)C#N |
Computed by PubChem (NCBI)