CAS 73425-12-4 is the registry number for 6-(Trifluoromethyl)indoline-2-thione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(trifluoromethyl)-1,3-dihydroindole-2-thione (CAS 73425-12-4) is a chemical compound with the molecular formula C9H6F3NS and a molecular weight of 217.21 g/mol. IUPAC name: 6-(trifluoromethyl)-1,3-dihydroindole-2-thione. InChIKey: ZRASJFSFKLZGNQ-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NS |
|---|---|
| Molecular weight | 217.21 g/mol |
| IUPAC name | 6-(trifluoromethyl)-1,3-dihydroindole-2-thione |
| InChIKey | ZRASJFSFKLZGNQ-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2)C(F)(F)F)NC1=S |
Computed by PubChem (NCBI)