CAS 161533-09-1 appears in our catalog under these names: Benzyl (5-bromopentyl)carbamate, 98%, 98%, Phenylmethyl N-(5-bromopentyl)carbamate, 97.0%, BENZYL (5-BROMOPENTYL)CARBAMATE, 95%. Offered by: Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100 mg, 500 mg, 250 mg.
Benzyl N-(5-bromopentyl)carbamate (CAS 161533-09-1) is a chemical compound with the molecular formula C13H18BrNO2 and a molecular weight of 300.19 g/mol. IUPAC name: benzyl N-(5-bromopentyl)carbamate. InChIKey: HYVGOGJCUXKVPW-UHFFFAOYSA-N.
| Molecular formula | C13H18BrNO2 |
|---|---|
| Molecular weight | 300.19 g/mol |
| IUPAC name | benzyl N-(5-bromopentyl)carbamate |
| InChIKey | HYVGOGJCUXKVPW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCCCCCBr |
Computed by PubChem (NCBI)